About 2-amino-N-[2-(2-methyl-3,5-dioxopiperazin-1-yl)-2-oxoethyl]acetamide
2-amino-N-[2-(2-methyl-3,5-dioxopiperazin-1-yl)-2-oxoethyl]acetamide (PubChem CID 66061602) has the molecular formula C9H14N4O4
and a molecular weight of 242.23 g/mol. Its IUPAC name is 2-amino-N-[2-(2-methyl-3,5-dioxopiperazin-1-yl)-2-oxoethyl]acetamide.
Molecular Properties
| Compound Name | 2-amino-N-[2-(2-methyl-3,5-dioxopiperazin-1-yl)-2-oxoethyl]acetamide |
| PubChem CID | 66061602 |
| Molecular Formula | C9H14N4O4 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 2-amino-N-[2-(2-methyl-3,5-dioxopiperazin-1-yl)-2-oxoethyl]acetamide |
| SMILES | CC1C(=O)NC(=O)CN1C(=O)CNC(=O)CN |
| InChI | InChI=1S/C9H14N4O4/c1-5-9(17)12-7(15)4-13(5)8(16)3-11-6(14)2-10/h5H,2-4,10H2,1H3,(H,11,14)(H,12,15,17) |
| InChIKey | WYLZUUSDAPDYNV-UHFFFAOYSA-N |
| XLogP | -3.07 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | -3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-N-[2-(2-methyl-3,5-dioxopiperazin-1-yl)-2-oxoethyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-[2-(2-methyl-3,5-dioxopiperazin-1-yl)-2-oxoethyl]acetamide?
The IUPAC name of 2-amino-N-[2-(2-methyl-3,5-dioxopiperazin-1-yl)-2-oxoethyl]acetamide (CID 66061602) is 2-amino-N-[2-(2-methyl-3,5-dioxopiperazin-1-yl)-2-oxoethyl]acetamide.
What is the SMILES notation for 2-amino-N-[2-(2-methyl-3,5-dioxopiperazin-1-yl)-2-oxoethyl]acetamide?
The canonical SMILES for 2-amino-N-[2-(2-methyl-3,5-dioxopiperazin-1-yl)-2-oxoethyl]acetamide is CC1C(=O)NC(=O)CN1C(=O)CNC(=O)CN.
What is the InChIKey of 2-amino-N-[2-(2-methyl-3,5-dioxopiperazin-1-yl)-2-oxoethyl]acetamide?
The InChIKey is WYLZUUSDAPDYNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N4O4/c1-5-9(17)12-7(15)4-13(5)8(16)3-11-6(14)2-10/h5H,2-4,10H2,1H3,(H,11,14)(H,12,15,17).
What are the key properties of 2-amino-N-[2-(2-methyl-3,5-dioxopiperazin-1-yl)-2-oxoethyl]acetamide?
2-amino-N-[2-(2-methyl-3,5-dioxopiperazin-1-yl)-2-oxoethyl]acetamide has a molecular weight of 242.23 g/mol, XLogP of -3.07, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-[2-(2-methyl-3,5-dioxopiperazin-1-yl)-2-oxoethyl]acetamide is sourced from PubChem (CID 66061602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).