C13H13N5O3 — CID 66062066
4-(5-amino-1H-indazole-3-carbonyl)-3-methylpiperazine-2,6-dione (PubChem CID 66062066) has the molecular formula C13H13N5O3 and a molecular weight of 287.28 g/mol. Its IUPAC name is 4-(5-amino-1H-indazole-3-carbonyl)-3-methylpiperazine-2,6-dione.
| Compound Name | 4-(5-amino-1H-indazole-3-carbonyl)-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66062066 |
| Molecular Formula | C13H13N5O3 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 4-(5-amino-1H-indazole-3-carbonyl)-3-methylpiperazine-2,6-dione |
| SMILES | CC1C(=O)NC(=O)CN1C(=O)c1n[nH]c2ccc(N)cc12 |
| InChI | InChI=1S/C13H13N5O3/c1-6-12(20)15-10(19)5-18(6)13(21)11-8-4-7(14)2-3-9(8)16-17-11/h2-4,6H,5,14H2,1H3,(H,16,17)(H,15,19,20) |
| InChIKey | CDVGGLSBPLINOZ-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 121.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|