About 4-(2,6-dichlorobenzoyl)-3-methylpiperazine-2,6-dione
4-(2,6-dichlorobenzoyl)-3-methylpiperazine-2,6-dione (PubChem CID 66062103) has the molecular formula C12H10Cl2N2O3
and a molecular weight of 301.13 g/mol. Its IUPAC name is 4-(2,6-dichlorobenzoyl)-3-methylpiperazine-2,6-dione.
Molecular Properties
| Compound Name | 4-(2,6-dichlorobenzoyl)-3-methylpiperazine-2,6-dione |
| PubChem CID | 66062103 |
| Molecular Formula | C12H10Cl2N2O3 |
| Molecular Weight | 301.13 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | 4-(2,6-dichlorobenzoyl)-3-methylpiperazine-2,6-dione |
| SMILES | CC1C(=O)NC(=O)CN1C(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H10Cl2N2O3/c1-6-11(18)15-9(17)5-16(6)12(19)10-7(13)3-2-4-8(10)14/h2-4,6H,5H2,1H3,(H,15,17,18) |
| InChIKey | KYYLSFXVTRDFRR-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.13 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,6-dichlorobenzoyl)-3-methylpiperazine-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,6-dichlorobenzoyl)-3-methylpiperazine-2,6-dione?
The IUPAC name of 4-(2,6-dichlorobenzoyl)-3-methylpiperazine-2,6-dione (CID 66062103) is 4-(2,6-dichlorobenzoyl)-3-methylpiperazine-2,6-dione.
What is the SMILES notation for 4-(2,6-dichlorobenzoyl)-3-methylpiperazine-2,6-dione?
The canonical SMILES for 4-(2,6-dichlorobenzoyl)-3-methylpiperazine-2,6-dione is CC1C(=O)NC(=O)CN1C(=O)c1c(Cl)cccc1Cl.
What is the InChIKey of 4-(2,6-dichlorobenzoyl)-3-methylpiperazine-2,6-dione?
The InChIKey is KYYLSFXVTRDFRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Cl2N2O3/c1-6-11(18)15-9(17)5-16(6)12(19)10-7(13)3-2-4-8(10)14/h2-4,6H,5H2,1H3,(H,15,17,18).
What are the key properties of 4-(2,6-dichlorobenzoyl)-3-methylpiperazine-2,6-dione?
4-(2,6-dichlorobenzoyl)-3-methylpiperazine-2,6-dione has a molecular weight of 301.13 g/mol, XLogP of 1.48, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,6-dichlorobenzoyl)-3-methylpiperazine-2,6-dione is sourced from PubChem (CID 66062103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).