C11H12N4O5 — CID 66062120
2-[2-(2-methyl-3,5-dioxopiperazin-1-yl)-2-oxoethyl]-1H-pyridazine-3,6-dione (PubChem CID 66062120) has the molecular formula C11H12N4O5 and a molecular weight of 280.24 g/mol. Its IUPAC name is 2-[2-(2-methyl-3,5-dioxopiperazin-1-yl)-2-oxoethyl]-1H-pyridazine-3,6-dione.
| Compound Name | 2-[2-(2-methyl-3,5-dioxopiperazin-1-yl)-2-oxoethyl]-1H-pyridazine-3,6-dione |
|---|---|
| PubChem CID | 66062120 |
| Molecular Formula | C11H12N4O5 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 2-[2-(2-methyl-3,5-dioxopiperazin-1-yl)-2-oxoethyl]-1H-pyridazine-3,6-dione |
| SMILES | CC1C(=O)NC(=O)CN1C(=O)Cn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C11H12N4O5/c1-6-11(20)12-8(17)4-14(6)10(19)5-15-9(18)3-2-7(16)13-15/h2-3,6H,4-5H2,1H3,(H,13,16)(H,12,17,20) |
| InChIKey | GOOHWNSLHYTFOE-UHFFFAOYSA-N |
| XLogP | -2.59 |
| TPSA | 121.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|