About 2-[(2-methyl-3,5-dioxopiperazin-1-yl)sulfonylmethyl]benzonitrile
2-[(2-methyl-3,5-dioxopiperazin-1-yl)sulfonylmethyl]benzonitrile (PubChem CID 66062183) has the molecular formula C13H13N3O4S
and a molecular weight of 307.33 g/mol. Its IUPAC name is 2-[(2-methyl-3,5-dioxopiperazin-1-yl)sulfonylmethyl]benzonitrile.
Molecular Properties
| Compound Name | 2-[(2-methyl-3,5-dioxopiperazin-1-yl)sulfonylmethyl]benzonitrile |
| PubChem CID | 66062183 |
| Molecular Formula | C13H13N3O4S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | 2-[(2-methyl-3,5-dioxopiperazin-1-yl)sulfonylmethyl]benzonitrile |
| SMILES | CC1C(=O)NC(=O)CN1S(=O)(=O)Cc1ccccc1C#N |
| InChI | InChI=1S/C13H13N3O4S/c1-9-13(18)15-12(17)7-16(9)21(19,20)8-11-5-3-2-4-10(11)6-14/h2-5,9H,7-8H2,1H3,(H,15,17,18) |
| InChIKey | AOVLWBNEKZKIQN-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 107.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-methyl-3,5-dioxopiperazin-1-yl)sulfonylmethyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-methyl-3,5-dioxopiperazin-1-yl)sulfonylmethyl]benzonitrile?
The IUPAC name of 2-[(2-methyl-3,5-dioxopiperazin-1-yl)sulfonylmethyl]benzonitrile (CID 66062183) is 2-[(2-methyl-3,5-dioxopiperazin-1-yl)sulfonylmethyl]benzonitrile.
What is the SMILES notation for 2-[(2-methyl-3,5-dioxopiperazin-1-yl)sulfonylmethyl]benzonitrile?
The canonical SMILES for 2-[(2-methyl-3,5-dioxopiperazin-1-yl)sulfonylmethyl]benzonitrile is CC1C(=O)NC(=O)CN1S(=O)(=O)Cc1ccccc1C#N.
What is the InChIKey of 2-[(2-methyl-3,5-dioxopiperazin-1-yl)sulfonylmethyl]benzonitrile?
The InChIKey is AOVLWBNEKZKIQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O4S/c1-9-13(18)15-12(17)7-16(9)21(19,20)8-11-5-3-2-4-10(11)6-14/h2-5,9H,7-8H2,1H3,(H,15,17,18).
What are the key properties of 2-[(2-methyl-3,5-dioxopiperazin-1-yl)sulfonylmethyl]benzonitrile?
2-[(2-methyl-3,5-dioxopiperazin-1-yl)sulfonylmethyl]benzonitrile has a molecular weight of 307.33 g/mol, XLogP of -0.27, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-methyl-3,5-dioxopiperazin-1-yl)sulfonylmethyl]benzonitrile is sourced from PubChem (CID 66062183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).