C11H21N3O2 — CID 66062279
4-(1-amino-3,3-dimethylbutan-2-yl)-3-methylpiperazine-2,6-dione (PubChem CID 66062279) has the molecular formula C11H21N3O2 and a molecular weight of 227.31 g/mol. Its IUPAC name is 4-(1-amino-3,3-dimethylbutan-2-yl)-3-methylpiperazine-2,6-dione.
| Compound Name | 4-(1-amino-3,3-dimethylbutan-2-yl)-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66062279 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | 4-(1-amino-3,3-dimethylbutan-2-yl)-3-methylpiperazine-2,6-dione |
| SMILES | CC1C(=O)NC(=O)CN1C(CN)C(C)(C)C |
| InChI | InChI=1S/C11H21N3O2/c1-7-10(16)13-9(15)6-14(7)8(5-12)11(2,3)4/h7-8H,5-6,12H2,1-4H3,(H,13,15,16) |
| InChIKey | OOZYNTGSBDNRCZ-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|