C12H17N3O5 — CID 66063186
1-(3,5-dioxopiperazine-1-carbonyl)-3-ethylpyrrolidine-3-carboxylic acid (PubChem CID 66063186) has the molecular formula C12H17N3O5 and a molecular weight of 283.28 g/mol. Its IUPAC name is 1-(3,5-dioxopiperazine-1-carbonyl)-3-ethylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-(3,5-dioxopiperazine-1-carbonyl)-3-ethylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 66063186 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 1-(3,5-dioxopiperazine-1-carbonyl)-3-ethylpyrrolidine-3-carboxylic acid |
| SMILES | CCC1(C(=O)O)CCN(C(=O)N2CC(=O)NC(=O)C2)C1 |
| InChI | InChI=1S/C12H17N3O5/c1-2-12(10(18)19)3-4-14(7-12)11(20)15-5-8(16)13-9(17)6-15/h2-7H2,1H3,(H,18,19)(H,13,16,17) |
| InChIKey | ZYPBYSWMPGRUNK-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|