C11H12N2O4 — CID 66063481
3-methyl-4-(5-methylfuran-2-carbonyl)piperazine-2,6-dione (PubChem CID 66063481) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is 3-methyl-4-(5-methylfuran-2-carbonyl)piperazine-2,6-dione.
| Compound Name | 3-methyl-4-(5-methylfuran-2-carbonyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 66063481 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 3-methyl-4-(5-methylfuran-2-carbonyl)piperazine-2,6-dione |
| SMILES | Cc1ccc(C(=O)N2CC(=O)NC(=O)C2C)o1 |
| InChI | InChI=1S/C11H12N2O4/c1-6-3-4-8(17-6)11(16)13-5-9(14)12-10(15)7(13)2/h3-4,7H,5H2,1-2H3,(H,12,14,15) |
| InChIKey | CTXNOKATHRLEBM-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|