C11H13N5O2S — CID 66063544
4-[5-(aminomethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-3-methylpiperazine-2,6-dione (PubChem CID 66063544) has the molecular formula C11H13N5O2S and a molecular weight of 279.32 g/mol. Its IUPAC name is 4-[5-(aminomethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-3-methylpiperazine-2,6-dione.
| Compound Name | 4-[5-(aminomethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66063544 |
| Molecular Formula | C11H13N5O2S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 4-[5-(aminomethyl)imidazo[2,1-b][1,3]thiazol-6-yl]-3-methylpiperazine-2,6-dione |
| SMILES | CC1C(=O)NC(=O)CN1c1nc2sccn2c1CN |
| InChI | InChI=1S/C11H13N5O2S/c1-6-10(18)13-8(17)5-16(6)9-7(4-12)15-2-3-19-11(15)14-9/h2-3,6H,4-5,12H2,1H3,(H,13,17,18) |
| InChIKey | YIKTULIQPQMONE-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 92.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|