C8H12N2O3S — CID 66063866
3-methyl-4-(2-methylsulfanylacetyl)piperazine-2,6-dione (PubChem CID 66063866) has the molecular formula C8H12N2O3S and a molecular weight of 216.26 g/mol. Its IUPAC name is 3-methyl-4-(2-methylsulfanylacetyl)piperazine-2,6-dione.
| Compound Name | 3-methyl-4-(2-methylsulfanylacetyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 66063866 |
| Molecular Formula | C8H12N2O3S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 3-methyl-4-(2-methylsulfanylacetyl)piperazine-2,6-dione |
| SMILES | CSCC(=O)N1CC(=O)NC(=O)C1C |
| InChI | InChI=1S/C8H12N2O3S/c1-5-8(13)9-6(11)3-10(5)7(12)4-14-2/h5H,3-4H2,1-2H3,(H,9,11,13) |
| InChIKey | KLGADTNBCZFAFW-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|