C13H18IN3O — CID 66064522
1-(2-amino-4-iodophenyl)-6-methylpiperidine-3-carboxamide (PubChem CID 66064522) has the molecular formula C13H18IN3O and a molecular weight of 359.21 g/mol. Its IUPAC name is 1-(2-amino-4-iodophenyl)-6-methylpiperidine-3-carboxamide.
| Compound Name | 1-(2-amino-4-iodophenyl)-6-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 66064522 |
| Molecular Formula | C13H18IN3O |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 1-(2-amino-4-iodophenyl)-6-methylpiperidine-3-carboxamide |
| SMILES | CC1CCC(C(N)=O)CN1c1ccc(I)cc1N |
| InChI | InChI=1S/C13H18IN3O/c1-8-2-3-9(13(16)18)7-17(8)12-5-4-10(14)6-11(12)15/h4-6,8-9H,2-3,7,15H2,1H3,(H2,16,18) |
| InChIKey | WRHVIAXZSLPXHP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|