About [2-(benzylamino)-2-oxoethyl] N-cyano-N'-prop-2-enylcarbamimidothioate
[2-(benzylamino)-2-oxoethyl] N-cyano-N'-prop-2-enylcarbamimidothioate (PubChem CID 660647) has the molecular formula C14H16N4OS
and a molecular weight of 288.38 g/mol. Its IUPAC name is [2-(benzylamino)-2-oxoethyl] N-cyano-N'-prop-2-enylcarbamimidothioate.
Molecular Properties
| Compound Name | [2-(benzylamino)-2-oxoethyl] N-cyano-N'-prop-2-enylcarbamimidothioate |
| PubChem CID | 660647 |
| Molecular Formula | C14H16N4OS |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | [2-(benzylamino)-2-oxoethyl] N-cyano-N'-prop-2-enylcarbamimidothioate |
| SMILES | C=CC/N=C(\NC#N)SCC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C14H16N4OS/c1-2-8-16-14(18-11-15)20-10-13(19)17-9-12-6-4-3-5-7-12/h2-7H,1,8-10H2,(H,16,18)(H,17,19) |
| InChIKey | OQQVHISJDABPNV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 77.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [2-(benzylamino)-2-oxoethyl] N-cyano-N'-prop-2-enylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(benzylamino)-2-oxoethyl] N-cyano-N'-prop-2-enylcarbamimidothioate?
The IUPAC name of [2-(benzylamino)-2-oxoethyl] N-cyano-N'-prop-2-enylcarbamimidothioate (CID 660647) is [2-(benzylamino)-2-oxoethyl] N-cyano-N'-prop-2-enylcarbamimidothioate.
What is the SMILES notation for [2-(benzylamino)-2-oxoethyl] N-cyano-N'-prop-2-enylcarbamimidothioate?
The canonical SMILES for [2-(benzylamino)-2-oxoethyl] N-cyano-N'-prop-2-enylcarbamimidothioate is C=CC/N=C(\NC#N)SCC(=O)NCc1ccccc1.
What is the InChIKey of [2-(benzylamino)-2-oxoethyl] N-cyano-N'-prop-2-enylcarbamimidothioate?
The InChIKey is OQQVHISJDABPNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4OS/c1-2-8-16-14(18-11-15)20-10-13(19)17-9-12-6-4-3-5-7-12/h2-7H,1,8-10H2,(H,16,18)(H,17,19).
What are the key properties of [2-(benzylamino)-2-oxoethyl] N-cyano-N'-prop-2-enylcarbamimidothioate?
[2-(benzylamino)-2-oxoethyl] N-cyano-N'-prop-2-enylcarbamimidothioate has a molecular weight of 288.38 g/mol, XLogP of 1.65, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(benzylamino)-2-oxoethyl] N-cyano-N'-prop-2-enylcarbamimidothioate is sourced from PubChem (CID 660647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).