C14H18FN3S — CID 66065137
N-[[2-[(4-fluorophenyl)sulfanylmethyl]-1H-imidazol-5-yl]methyl]propan-1-amine (PubChem CID 66065137) has the molecular formula C14H18FN3S and a molecular weight of 279.38 g/mol. Its IUPAC name is N-[[2-[(4-fluorophenyl)sulfanylmethyl]-1H-imidazol-5-yl]methyl]propan-1-amine.
| Compound Name | N-[[2-[(4-fluorophenyl)sulfanylmethyl]-1H-imidazol-5-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 66065137 |
| Molecular Formula | C14H18FN3S |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | N-[[2-[(4-fluorophenyl)sulfanylmethyl]-1H-imidazol-5-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cnc(CSc2ccc(F)cc2)[nH]1 |
| InChI | InChI=1S/C14H18FN3S/c1-2-7-16-8-12-9-17-14(18-12)10-19-13-5-3-11(15)4-6-13/h3-6,9,16H,2,7-8,10H2,1H3,(H,17,18) |
| InChIKey | ICEICXYQPYYXPA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|