C13H15N3O4 — CID 66067569
4-(5-cyclopropyl-1,2-oxazole-3-carbonyl)-3-ethylpiperazine-2,6-dione (PubChem CID 66067569) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is 4-(5-cyclopropyl-1,2-oxazole-3-carbonyl)-3-ethylpiperazine-2,6-dione.
| Compound Name | 4-(5-cyclopropyl-1,2-oxazole-3-carbonyl)-3-ethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66067569 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 4-(5-cyclopropyl-1,2-oxazole-3-carbonyl)-3-ethylpiperazine-2,6-dione |
| SMILES | CCC1C(=O)NC(=O)CN1C(=O)c1cc(C2CC2)on1 |
| InChI | InChI=1S/C13H15N3O4/c1-2-9-12(18)14-11(17)6-16(9)13(19)8-5-10(20-15-8)7-3-4-7/h5,7,9H,2-4,6H2,1H3,(H,14,17,18) |
| InChIKey | CPEVIGQCFRNBOY-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|