About 3-(3-ethyl-2,6-dioxopiperazin-1-yl)-N,N-dimethylpropanamide
3-(3-ethyl-2,6-dioxopiperazin-1-yl)-N,N-dimethylpropanamide (PubChem CID 66068228) has the molecular formula C11H19N3O3
and a molecular weight of 241.29 g/mol. Its IUPAC name is 3-(3-ethyl-2,6-dioxopiperazin-1-yl)-N,N-dimethylpropanamide.
Molecular Properties
| Compound Name | 3-(3-ethyl-2,6-dioxopiperazin-1-yl)-N,N-dimethylpropanamide |
| PubChem CID | 66068228 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 3-(3-ethyl-2,6-dioxopiperazin-1-yl)-N,N-dimethylpropanamide |
| SMILES | CCC1NCC(=O)N(CCC(=O)N(C)C)C1=O |
| InChI | InChI=1S/C11H19N3O3/c1-4-8-11(17)14(10(16)7-12-8)6-5-9(15)13(2)3/h8,12H,4-7H2,1-3H3 |
| InChIKey | KEFFVJWSJRVHQL-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-ethyl-2,6-dioxopiperazin-1-yl)-N,N-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-ethyl-2,6-dioxopiperazin-1-yl)-N,N-dimethylpropanamide?
The IUPAC name of 3-(3-ethyl-2,6-dioxopiperazin-1-yl)-N,N-dimethylpropanamide (CID 66068228) is 3-(3-ethyl-2,6-dioxopiperazin-1-yl)-N,N-dimethylpropanamide.
What is the SMILES notation for 3-(3-ethyl-2,6-dioxopiperazin-1-yl)-N,N-dimethylpropanamide?
The canonical SMILES for 3-(3-ethyl-2,6-dioxopiperazin-1-yl)-N,N-dimethylpropanamide is CCC1NCC(=O)N(CCC(=O)N(C)C)C1=O.
What is the InChIKey of 3-(3-ethyl-2,6-dioxopiperazin-1-yl)-N,N-dimethylpropanamide?
The InChIKey is KEFFVJWSJRVHQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O3/c1-4-8-11(17)14(10(16)7-12-8)6-5-9(15)13(2)3/h8,12H,4-7H2,1-3H3.
What are the key properties of 3-(3-ethyl-2,6-dioxopiperazin-1-yl)-N,N-dimethylpropanamide?
3-(3-ethyl-2,6-dioxopiperazin-1-yl)-N,N-dimethylpropanamide has a molecular weight of 241.29 g/mol, XLogP of -0.80, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-ethyl-2,6-dioxopiperazin-1-yl)-N,N-dimethylpropanamide is sourced from PubChem (CID 66068228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).