C12H17N3O6 — CID 66068249
3-[(2,2-dimethyl-3,5-dioxopiperazine-1-carbonyl)amino]oxolane-3-carboxylic acid (PubChem CID 66068249) has the molecular formula C12H17N3O6 and a molecular weight of 299.28 g/mol. Its IUPAC name is 3-[(2,2-dimethyl-3,5-dioxopiperazine-1-carbonyl)amino]oxolane-3-carboxylic acid.
| Compound Name | 3-[(2,2-dimethyl-3,5-dioxopiperazine-1-carbonyl)amino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 66068249 |
| Molecular Formula | C12H17N3O6 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 3-[(2,2-dimethyl-3,5-dioxopiperazine-1-carbonyl)amino]oxolane-3-carboxylic acid |
| SMILES | CC1(C)C(=O)NC(=O)CN1C(=O)NC1(C(=O)O)CCOC1 |
| InChI | InChI=1S/C12H17N3O6/c1-11(2)8(17)13-7(16)5-15(11)10(20)14-12(9(18)19)3-4-21-6-12/h3-6H2,1-2H3,(H,14,20)(H,18,19)(H,13,16,17) |
| InChIKey | LZFLABQUOIPJMS-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|