C14H20N4O3 — CID 66068522
4-[3-(3,5-dimethylpyrazol-1-yl)propanoyl]-3-ethylpiperazine-2,6-dione (PubChem CID 66068522) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is 4-[3-(3,5-dimethylpyrazol-1-yl)propanoyl]-3-ethylpiperazine-2,6-dione.
| Compound Name | 4-[3-(3,5-dimethylpyrazol-1-yl)propanoyl]-3-ethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66068522 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 4-[3-(3,5-dimethylpyrazol-1-yl)propanoyl]-3-ethylpiperazine-2,6-dione |
| SMILES | CCC1C(=O)NC(=O)CN1C(=O)CCn1nc(C)cc1C |
| InChI | InChI=1S/C14H20N4O3/c1-4-11-14(21)15-12(19)8-17(11)13(20)5-6-18-10(3)7-9(2)16-18/h7,11H,4-6,8H2,1-3H3,(H,15,19,21) |
| InChIKey | ZMFRWRZHLAXOOZ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|