About ethyl 6-ethoxycarbonyloxy-2,2,4-trimethylquinoline-1-carboxylate
ethyl 6-ethoxycarbonyloxy-2,2,4-trimethylquinoline-1-carboxylate (PubChem CID 660687) has the molecular formula C18H23NO5
and a molecular weight of 333.38 g/mol. Its IUPAC name is ethyl 6-ethoxycarbonyloxy-2,2,4-trimethylquinoline-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-ethoxycarbonyloxy-2,2,4-trimethylquinoline-1-carboxylate |
| PubChem CID | 660687 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | ethyl 6-ethoxycarbonyloxy-2,2,4-trimethylquinoline-1-carboxylate |
| SMILES | CCOC(=O)Oc1ccc2c(c1)C(C)=CC(C)(C)N2C(=O)OCC |
| InChI | InChI=1S/C18H23NO5/c1-6-22-16(20)19-15-9-8-13(24-17(21)23-7-2)10-14(15)12(3)11-18(19,4)5/h8-11H,6-7H2,1-5H3 |
| InChIKey | UWZZDZNGXRTAFU-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze ethyl 6-ethoxycarbonyloxy-2,2,4-trimethylquinoline-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-ethoxycarbonyloxy-2,2,4-trimethylquinoline-1-carboxylate?
The IUPAC name of ethyl 6-ethoxycarbonyloxy-2,2,4-trimethylquinoline-1-carboxylate (CID 660687) is ethyl 6-ethoxycarbonyloxy-2,2,4-trimethylquinoline-1-carboxylate.
What is the SMILES notation for ethyl 6-ethoxycarbonyloxy-2,2,4-trimethylquinoline-1-carboxylate?
The canonical SMILES for ethyl 6-ethoxycarbonyloxy-2,2,4-trimethylquinoline-1-carboxylate is CCOC(=O)Oc1ccc2c(c1)C(C)=CC(C)(C)N2C(=O)OCC.
What is the InChIKey of ethyl 6-ethoxycarbonyloxy-2,2,4-trimethylquinoline-1-carboxylate?
The InChIKey is UWZZDZNGXRTAFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23NO5/c1-6-22-16(20)19-15-9-8-13(24-17(21)23-7-2)10-14(15)12(3)11-18(19,4)5/h8-11H,6-7H2,1-5H3.
What are the key properties of ethyl 6-ethoxycarbonyloxy-2,2,4-trimethylquinoline-1-carboxylate?
ethyl 6-ethoxycarbonyloxy-2,2,4-trimethylquinoline-1-carboxylate has a molecular weight of 333.38 g/mol, XLogP of 4.38, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-ethoxycarbonyloxy-2,2,4-trimethylquinoline-1-carboxylate is sourced from PubChem (CID 660687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).