About 2-[(2-ethyl-3,5-dioxopiperazine-1-carbonyl)amino]-2-methylpentanoic acid
2-[(2-ethyl-3,5-dioxopiperazine-1-carbonyl)amino]-2-methylpentanoic acid (PubChem CID 66068985) has the molecular formula C13H21N3O5
and a molecular weight of 299.33 g/mol. Its IUPAC name is 2-[(2-ethyl-3,5-dioxopiperazine-1-carbonyl)amino]-2-methylpentanoic acid.
Molecular Properties
| Compound Name | 2-[(2-ethyl-3,5-dioxopiperazine-1-carbonyl)amino]-2-methylpentanoic acid |
| PubChem CID | 66068985 |
| Molecular Formula | C13H21N3O5 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 2-[(2-ethyl-3,5-dioxopiperazine-1-carbonyl)amino]-2-methylpentanoic acid |
| SMILES | CCCC(C)(NC(=O)N1CC(=O)NC(=O)C1CC)C(=O)O |
| InChI | InChI=1S/C13H21N3O5/c1-4-6-13(3,11(19)20)15-12(21)16-7-9(17)14-10(18)8(16)5-2/h8H,4-7H2,1-3H3,(H,15,21)(H,19,20)(H,14,17,18) |
| InChIKey | IGKFMFCLRUMESB-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-ethyl-3,5-dioxopiperazine-1-carbonyl)amino]-2-methylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-ethyl-3,5-dioxopiperazine-1-carbonyl)amino]-2-methylpentanoic acid?
The IUPAC name of 2-[(2-ethyl-3,5-dioxopiperazine-1-carbonyl)amino]-2-methylpentanoic acid (CID 66068985) is 2-[(2-ethyl-3,5-dioxopiperazine-1-carbonyl)amino]-2-methylpentanoic acid.
What is the SMILES notation for 2-[(2-ethyl-3,5-dioxopiperazine-1-carbonyl)amino]-2-methylpentanoic acid?
The canonical SMILES for 2-[(2-ethyl-3,5-dioxopiperazine-1-carbonyl)amino]-2-methylpentanoic acid is CCCC(C)(NC(=O)N1CC(=O)NC(=O)C1CC)C(=O)O.
What is the InChIKey of 2-[(2-ethyl-3,5-dioxopiperazine-1-carbonyl)amino]-2-methylpentanoic acid?
The InChIKey is IGKFMFCLRUMESB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O5/c1-4-6-13(3,11(19)20)15-12(21)16-7-9(17)14-10(18)8(16)5-2/h8H,4-7H2,1-3H3,(H,15,21)(H,19,20)(H,14,17,18).
What are the key properties of 2-[(2-ethyl-3,5-dioxopiperazine-1-carbonyl)amino]-2-methylpentanoic acid?
2-[(2-ethyl-3,5-dioxopiperazine-1-carbonyl)amino]-2-methylpentanoic acid has a molecular weight of 299.33 g/mol, XLogP of 0.08, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-ethyl-3,5-dioxopiperazine-1-carbonyl)amino]-2-methylpentanoic acid is sourced from PubChem (CID 66068985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).