C14H23N5O2 — CID 66069633
4-[2-amino-1-(1-methylpyrazol-4-yl)butyl]-3-ethylpiperazine-2,6-dione (PubChem CID 66069633) has the molecular formula C14H23N5O2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 4-[2-amino-1-(1-methylpyrazol-4-yl)butyl]-3-ethylpiperazine-2,6-dione.
| Compound Name | 4-[2-amino-1-(1-methylpyrazol-4-yl)butyl]-3-ethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66069633 |
| Molecular Formula | C14H23N5O2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 4-[2-amino-1-(1-methylpyrazol-4-yl)butyl]-3-ethylpiperazine-2,6-dione |
| SMILES | CCC(N)C(c1cnn(C)c1)N1CC(=O)NC(=O)C1CC |
| InChI | InChI=1S/C14H23N5O2/c1-4-10(15)13(9-6-16-18(3)7-9)19-8-12(20)17-14(21)11(19)5-2/h6-7,10-11,13H,4-5,8,15H2,1-3H3,(H,17,20,21) |
| InChIKey | QHHWRWZFBZVWFJ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|