C15H19FN4S — CID 66072321
[6-tert-butyl-2-[(3-fluorophenyl)sulfanylmethyl]pyrimidin-4-yl]hydrazine (PubChem CID 66072321) has the molecular formula C15H19FN4S and a molecular weight of 306.41 g/mol. Its IUPAC name is [6-tert-butyl-2-[(3-fluorophenyl)sulfanylmethyl]pyrimidin-4-yl]hydrazine.
| Compound Name | [6-tert-butyl-2-[(3-fluorophenyl)sulfanylmethyl]pyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 66072321 |
| Molecular Formula | C15H19FN4S |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | [6-tert-butyl-2-[(3-fluorophenyl)sulfanylmethyl]pyrimidin-4-yl]hydrazine |
| SMILES | CC(C)(C)c1cc(NN)nc(CSc2cccc(F)c2)n1 |
| InChI | InChI=1S/C15H19FN4S/c1-15(2,3)12-8-13(20-17)19-14(18-12)9-21-11-6-4-5-10(16)7-11/h4-8H,9,17H2,1-3H3,(H,18,19,20) |
| InChIKey | WZLHTUAHKXNQDV-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|