C15H20FN3OS — CID 66072592
3-[3-[(4-fluorophenyl)sulfanylmethyl]-1,2,4-oxadiazol-5-yl]-N-propan-2-ylpropan-1-amine (PubChem CID 66072592) has the molecular formula C15H20FN3OS and a molecular weight of 309.41 g/mol. Its IUPAC name is 3-[3-[(4-fluorophenyl)sulfanylmethyl]-1,2,4-oxadiazol-5-yl]-N-propan-2-ylpropan-1-amine.
| Compound Name | 3-[3-[(4-fluorophenyl)sulfanylmethyl]-1,2,4-oxadiazol-5-yl]-N-propan-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 66072592 |
| Molecular Formula | C15H20FN3OS |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 3-[3-[(4-fluorophenyl)sulfanylmethyl]-1,2,4-oxadiazol-5-yl]-N-propan-2-ylpropan-1-amine |
| SMILES | CC(C)NCCCc1nc(CSc2ccc(F)cc2)no1 |
| InChI | InChI=1S/C15H20FN3OS/c1-11(2)17-9-3-4-15-18-14(19-20-15)10-21-13-7-5-12(16)6-8-13/h5-8,11,17H,3-4,9-10H2,1-2H3 |
| InChIKey | BGOZCNXLXNBNHL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|