About 4-methoxy-2,3-dihydrothiochromene-4-carbonitrile
4-methoxy-2,3-dihydrothiochromene-4-carbonitrile (PubChem CID 66072767) has the molecular formula C11H11NOS
and a molecular weight of 205.28 g/mol. Its IUPAC name is 4-methoxy-2,3-dihydrothiochromene-4-carbonitrile.
Molecular Properties
| Compound Name | 4-methoxy-2,3-dihydrothiochromene-4-carbonitrile |
| PubChem CID | 66072767 |
| Molecular Formula | C11H11NOS |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 4-methoxy-2,3-dihydrothiochromene-4-carbonitrile |
| SMILES | COC1(C#N)CCSc2ccccc21 |
| InChI | InChI=1S/C11H11NOS/c1-13-11(8-12)6-7-14-10-5-3-2-4-9(10)11/h2-5H,6-7H2,1H3 |
| InChIKey | PFPIHTIQTCLHTM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methoxy-2,3-dihydrothiochromene-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-2,3-dihydrothiochromene-4-carbonitrile?
The IUPAC name of 4-methoxy-2,3-dihydrothiochromene-4-carbonitrile (CID 66072767) is 4-methoxy-2,3-dihydrothiochromene-4-carbonitrile.
What is the SMILES notation for 4-methoxy-2,3-dihydrothiochromene-4-carbonitrile?
The canonical SMILES for 4-methoxy-2,3-dihydrothiochromene-4-carbonitrile is COC1(C#N)CCSc2ccccc21.
What is the InChIKey of 4-methoxy-2,3-dihydrothiochromene-4-carbonitrile?
The InChIKey is PFPIHTIQTCLHTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NOS/c1-13-11(8-12)6-7-14-10-5-3-2-4-9(10)11/h2-5H,6-7H2,1H3.
What are the key properties of 4-methoxy-2,3-dihydrothiochromene-4-carbonitrile?
4-methoxy-2,3-dihydrothiochromene-4-carbonitrile has a molecular weight of 205.28 g/mol, XLogP of 2.55, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2,3-dihydrothiochromene-4-carbonitrile is sourced from PubChem (CID 66072767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).