C11H14FN5S — CID 66072941
3-[5-[(3-fluorophenyl)sulfanylmethyl]tetrazol-1-yl]propan-1-amine (PubChem CID 66072941) has the molecular formula C11H14FN5S and a molecular weight of 267.33 g/mol. Its IUPAC name is 3-[5-[(3-fluorophenyl)sulfanylmethyl]tetrazol-1-yl]propan-1-amine.
| Compound Name | 3-[5-[(3-fluorophenyl)sulfanylmethyl]tetrazol-1-yl]propan-1-amine |
|---|---|
| PubChem CID | 66072941 |
| Molecular Formula | C11H14FN5S |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 3-[5-[(3-fluorophenyl)sulfanylmethyl]tetrazol-1-yl]propan-1-amine |
| SMILES | NCCCn1nnnc1CSc1cccc(F)c1 |
| InChI | InChI=1S/C11H14FN5S/c12-9-3-1-4-10(7-9)18-8-11-14-15-16-17(11)6-2-5-13/h1,3-4,7H,2,5-6,8,13H2 |
| InChIKey | BRJIQXNWKDSKIC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |