About N-methyl-2-(3-methyl-2,6-dioxopiperazin-1-yl)-N-propan-2-ylacetamide
N-methyl-2-(3-methyl-2,6-dioxopiperazin-1-yl)-N-propan-2-ylacetamide (PubChem CID 66073544) has the molecular formula C11H19N3O3
and a molecular weight of 241.29 g/mol. Its IUPAC name is N-methyl-2-(3-methyl-2,6-dioxopiperazin-1-yl)-N-propan-2-ylacetamide.
Molecular Properties
| Compound Name | N-methyl-2-(3-methyl-2,6-dioxopiperazin-1-yl)-N-propan-2-ylacetamide |
| PubChem CID | 66073544 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | N-methyl-2-(3-methyl-2,6-dioxopiperazin-1-yl)-N-propan-2-ylacetamide |
| SMILES | CC1NCC(=O)N(CC(=O)N(C)C(C)C)C1=O |
| InChI | InChI=1S/C11H19N3O3/c1-7(2)13(4)10(16)6-14-9(15)5-12-8(3)11(14)17/h7-8,12H,5-6H2,1-4H3 |
| InChIKey | JBEZYSBIOOSVHE-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-2-(3-methyl-2,6-dioxopiperazin-1-yl)-N-propan-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-(3-methyl-2,6-dioxopiperazin-1-yl)-N-propan-2-ylacetamide?
The IUPAC name of N-methyl-2-(3-methyl-2,6-dioxopiperazin-1-yl)-N-propan-2-ylacetamide (CID 66073544) is N-methyl-2-(3-methyl-2,6-dioxopiperazin-1-yl)-N-propan-2-ylacetamide.
What is the SMILES notation for N-methyl-2-(3-methyl-2,6-dioxopiperazin-1-yl)-N-propan-2-ylacetamide?
The canonical SMILES for N-methyl-2-(3-methyl-2,6-dioxopiperazin-1-yl)-N-propan-2-ylacetamide is CC1NCC(=O)N(CC(=O)N(C)C(C)C)C1=O.
What is the InChIKey of N-methyl-2-(3-methyl-2,6-dioxopiperazin-1-yl)-N-propan-2-ylacetamide?
The InChIKey is JBEZYSBIOOSVHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O3/c1-7(2)13(4)10(16)6-14-9(15)5-12-8(3)11(14)17/h7-8,12H,5-6H2,1-4H3.
What are the key properties of N-methyl-2-(3-methyl-2,6-dioxopiperazin-1-yl)-N-propan-2-ylacetamide?
N-methyl-2-(3-methyl-2,6-dioxopiperazin-1-yl)-N-propan-2-ylacetamide has a molecular weight of 241.29 g/mol, XLogP of -0.80, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-(3-methyl-2,6-dioxopiperazin-1-yl)-N-propan-2-ylacetamide is sourced from PubChem (CID 66073544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).