About 3-[(3-methyl-2,6-dioxopiperazin-1-yl)methyl]pyridine-2-carbonitrile
3-[(3-methyl-2,6-dioxopiperazin-1-yl)methyl]pyridine-2-carbonitrile (PubChem CID 66073552) has the molecular formula C12H12N4O2
and a molecular weight of 244.25 g/mol. Its IUPAC name is 3-[(3-methyl-2,6-dioxopiperazin-1-yl)methyl]pyridine-2-carbonitrile.
Molecular Properties
| Compound Name | 3-[(3-methyl-2,6-dioxopiperazin-1-yl)methyl]pyridine-2-carbonitrile |
| PubChem CID | 66073552 |
| Molecular Formula | C12H12N4O2 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 3-[(3-methyl-2,6-dioxopiperazin-1-yl)methyl]pyridine-2-carbonitrile |
| SMILES | CC1NCC(=O)N(Cc2cccnc2C#N)C1=O |
| InChI | InChI=1S/C12H12N4O2/c1-8-12(18)16(11(17)6-15-8)7-9-3-2-4-14-10(9)5-13/h2-4,8,15H,6-7H2,1H3 |
| InChIKey | LOHVWVHDZSINAI-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3-methyl-2,6-dioxopiperazin-1-yl)methyl]pyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-methyl-2,6-dioxopiperazin-1-yl)methyl]pyridine-2-carbonitrile?
The IUPAC name of 3-[(3-methyl-2,6-dioxopiperazin-1-yl)methyl]pyridine-2-carbonitrile (CID 66073552) is 3-[(3-methyl-2,6-dioxopiperazin-1-yl)methyl]pyridine-2-carbonitrile.
What is the SMILES notation for 3-[(3-methyl-2,6-dioxopiperazin-1-yl)methyl]pyridine-2-carbonitrile?
The canonical SMILES for 3-[(3-methyl-2,6-dioxopiperazin-1-yl)methyl]pyridine-2-carbonitrile is CC1NCC(=O)N(Cc2cccnc2C#N)C1=O.
What is the InChIKey of 3-[(3-methyl-2,6-dioxopiperazin-1-yl)methyl]pyridine-2-carbonitrile?
The InChIKey is LOHVWVHDZSINAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4O2/c1-8-12(18)16(11(17)6-15-8)7-9-3-2-4-14-10(9)5-13/h2-4,8,15H,6-7H2,1H3.
What are the key properties of 3-[(3-methyl-2,6-dioxopiperazin-1-yl)methyl]pyridine-2-carbonitrile?
3-[(3-methyl-2,6-dioxopiperazin-1-yl)methyl]pyridine-2-carbonitrile has a molecular weight of 244.25 g/mol, XLogP of -0.20, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-methyl-2,6-dioxopiperazin-1-yl)methyl]pyridine-2-carbonitrile is sourced from PubChem (CID 66073552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).