C15H25N3O3 — CID 66073855
3,3-dimethyl-4-(3-propylpiperidine-3-carbonyl)piperazine-2,6-dione (PubChem CID 66073855) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is 3,3-dimethyl-4-(3-propylpiperidine-3-carbonyl)piperazine-2,6-dione.
| Compound Name | 3,3-dimethyl-4-(3-propylpiperidine-3-carbonyl)piperazine-2,6-dione |
|---|---|
| PubChem CID | 66073855 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 3,3-dimethyl-4-(3-propylpiperidine-3-carbonyl)piperazine-2,6-dione |
| SMILES | CCCC1(C(=O)N2CC(=O)NC(=O)C2(C)C)CCCNC1 |
| InChI | InChI=1S/C15H25N3O3/c1-4-6-15(7-5-8-16-10-15)13(21)18-9-11(19)17-12(20)14(18,2)3/h16H,4-10H2,1-3H3,(H,17,19,20) |
| InChIKey | JLWOJVJYBIHHSN-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|