C10H14N4O4S2 — CID 66073870
4-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfonyl]-3,3-dimethylpiperazine-2,6-dione (PubChem CID 66073870) has the molecular formula C10H14N4O4S2 and a molecular weight of 318.38 g/mol. Its IUPAC name is 4-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfonyl]-3,3-dimethylpiperazine-2,6-dione.
| Compound Name | 4-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfonyl]-3,3-dimethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66073870 |
| Molecular Formula | C10H14N4O4S2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 4-[(2-amino-4-methyl-1,3-thiazol-5-yl)sulfonyl]-3,3-dimethylpiperazine-2,6-dione |
| SMILES | Cc1nc(N)sc1S(=O)(=O)N1CC(=O)NC(=O)C1(C)C |
| InChI | InChI=1S/C10H14N4O4S2/c1-5-7(19-9(11)12-5)20(17,18)14-4-6(15)13-8(16)10(14,2)3/h4H2,1-3H3,(H2,11,12)(H,13,15,16) |
| InChIKey | NQCOJELYPODEKH-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 122.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|