C11H14N4O3S — CID 66074040
4-[2-(2-amino-1,3-thiazol-4-yl)acetyl]-3,3-dimethylpiperazine-2,6-dione (PubChem CID 66074040) has the molecular formula C11H14N4O3S and a molecular weight of 282.32 g/mol. Its IUPAC name is 4-[2-(2-amino-1,3-thiazol-4-yl)acetyl]-3,3-dimethylpiperazine-2,6-dione.
| Compound Name | 4-[2-(2-amino-1,3-thiazol-4-yl)acetyl]-3,3-dimethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66074040 |
| Molecular Formula | C11H14N4O3S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 4-[2-(2-amino-1,3-thiazol-4-yl)acetyl]-3,3-dimethylpiperazine-2,6-dione |
| SMILES | CC1(C)C(=O)NC(=O)CN1C(=O)Cc1csc(N)n1 |
| InChI | InChI=1S/C11H14N4O3S/c1-11(2)9(18)14-7(16)4-15(11)8(17)3-6-5-19-10(12)13-6/h5H,3-4H2,1-2H3,(H2,12,13)(H,14,16,18) |
| InChIKey | NPEBOGYWIXZWDU-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|