C10H19N3O4S — CID 66074047
N,N-diethyl-2,2-dimethyl-3,5-dioxopiperazine-1-sulfonamide (PubChem CID 66074047) has the molecular formula C10H19N3O4S and a molecular weight of 277.35 g/mol. Its IUPAC name is N,N-diethyl-2,2-dimethyl-3,5-dioxopiperazine-1-sulfonamide.
| Compound Name | N,N-diethyl-2,2-dimethyl-3,5-dioxopiperazine-1-sulfonamide |
|---|---|
| PubChem CID | 66074047 |
| Molecular Formula | C10H19N3O4S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | N,N-diethyl-2,2-dimethyl-3,5-dioxopiperazine-1-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)N1CC(=O)NC(=O)C1(C)C |
| InChI | InChI=1S/C10H19N3O4S/c1-5-12(6-2)18(16,17)13-7-8(14)11-9(15)10(13,3)4/h5-7H2,1-4H3,(H,11,14,15) |
| InChIKey | VKUPPXNWJCNRJU-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|