About 2,2-dimethyl-3,5-dioxopiperazine-1-sulfonamide
2,2-dimethyl-3,5-dioxopiperazine-1-sulfonamide (PubChem CID 66074806) has the molecular formula C6H11N3O4S
and a molecular weight of 221.24 g/mol. Its IUPAC name is 2,2-dimethyl-3,5-dioxopiperazine-1-sulfonamide.
Molecular Properties
| Compound Name | 2,2-dimethyl-3,5-dioxopiperazine-1-sulfonamide |
| PubChem CID | 66074806 |
| Molecular Formula | C6H11N3O4S |
| Molecular Weight | 221.24 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 2,2-dimethyl-3,5-dioxopiperazine-1-sulfonamide |
| SMILES | CC1(C)C(=O)NC(=O)CN1S(N)(=O)=O |
| InChI | InChI=1S/C6H11N3O4S/c1-6(2)5(11)8-4(10)3-9(6)14(7,12)13/h3H2,1-2H3,(H2,7,12,13)(H,8,10,11) |
| InChIKey | BYLVSLJYOAGJIY-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.24 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-3,5-dioxopiperazine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-3,5-dioxopiperazine-1-sulfonamide?
The IUPAC name of 2,2-dimethyl-3,5-dioxopiperazine-1-sulfonamide (CID 66074806) is 2,2-dimethyl-3,5-dioxopiperazine-1-sulfonamide.
What is the SMILES notation for 2,2-dimethyl-3,5-dioxopiperazine-1-sulfonamide?
The canonical SMILES for 2,2-dimethyl-3,5-dioxopiperazine-1-sulfonamide is CC1(C)C(=O)NC(=O)CN1S(N)(=O)=O.
What is the InChIKey of 2,2-dimethyl-3,5-dioxopiperazine-1-sulfonamide?
The InChIKey is BYLVSLJYOAGJIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O4S/c1-6(2)5(11)8-4(10)3-9(6)14(7,12)13/h3H2,1-2H3,(H2,7,12,13)(H,8,10,11).
What are the key properties of 2,2-dimethyl-3,5-dioxopiperazine-1-sulfonamide?
2,2-dimethyl-3,5-dioxopiperazine-1-sulfonamide has a molecular weight of 221.24 g/mol, XLogP of -2.07, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-3,5-dioxopiperazine-1-sulfonamide is sourced from PubChem (CID 66074806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).