About 2-methyl-3,5-dioxopiperazine-1-carbohydrazide
2-methyl-3,5-dioxopiperazine-1-carbohydrazide (PubChem CID 66074885) has the molecular formula C6H10N4O3
and a molecular weight of 186.17 g/mol. Its IUPAC name is 2-methyl-3,5-dioxopiperazine-1-carbohydrazide.
Molecular Properties
| Compound Name | 2-methyl-3,5-dioxopiperazine-1-carbohydrazide |
| PubChem CID | 66074885 |
| Molecular Formula | C6H10N4O3 |
| Molecular Weight | 186.17 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 2-methyl-3,5-dioxopiperazine-1-carbohydrazide |
| SMILES | CC1C(=O)NC(=O)CN1C(=O)NN |
| InChI | InChI=1S/C6H10N4O3/c1-3-5(12)8-4(11)2-10(3)6(13)9-7/h3H,2,7H2,1H3,(H,9,13)(H,8,11,12) |
| InChIKey | GJSIMTUKVMQSEH-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.17 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-3,5-dioxopiperazine-1-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3,5-dioxopiperazine-1-carbohydrazide?
The IUPAC name of 2-methyl-3,5-dioxopiperazine-1-carbohydrazide (CID 66074885) is 2-methyl-3,5-dioxopiperazine-1-carbohydrazide.
What is the SMILES notation for 2-methyl-3,5-dioxopiperazine-1-carbohydrazide?
The canonical SMILES for 2-methyl-3,5-dioxopiperazine-1-carbohydrazide is CC1C(=O)NC(=O)CN1C(=O)NN.
What is the InChIKey of 2-methyl-3,5-dioxopiperazine-1-carbohydrazide?
The InChIKey is GJSIMTUKVMQSEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4O3/c1-3-5(12)8-4(11)2-10(3)6(13)9-7/h3H,2,7H2,1H3,(H,9,13)(H,8,11,12).
What are the key properties of 2-methyl-3,5-dioxopiperazine-1-carbohydrazide?
2-methyl-3,5-dioxopiperazine-1-carbohydrazide has a molecular weight of 186.17 g/mol, XLogP of -2.08, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3,5-dioxopiperazine-1-carbohydrazide is sourced from PubChem (CID 66074885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).