C13H20N2O4 — CID 66074953
3,3-dimethyl-4-[3-(oxolan-2-yl)propanoyl]piperazine-2,6-dione (PubChem CID 66074953) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 3,3-dimethyl-4-[3-(oxolan-2-yl)propanoyl]piperazine-2,6-dione.
| Compound Name | 3,3-dimethyl-4-[3-(oxolan-2-yl)propanoyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 66074953 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 3,3-dimethyl-4-[3-(oxolan-2-yl)propanoyl]piperazine-2,6-dione |
| SMILES | CC1(C)C(=O)NC(=O)CN1C(=O)CCC1CCCO1 |
| InChI | InChI=1S/C13H20N2O4/c1-13(2)12(18)14-10(16)8-15(13)11(17)6-5-9-4-3-7-19-9/h9H,3-8H2,1-2H3,(H,14,16,18) |
| InChIKey | VNDAHTPJHLOTGW-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|