C10H12N4O6S — CID 66075015
4-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl]-3,3-dimethylpiperazine-2,6-dione (PubChem CID 66075015) has the molecular formula C10H12N4O6S and a molecular weight of 316.30 g/mol. Its IUPAC name is 4-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl]-3,3-dimethylpiperazine-2,6-dione.
| Compound Name | 4-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl]-3,3-dimethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66075015 |
| Molecular Formula | C10H12N4O6S |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 316.05 |
| IUPAC Name | 4-[(2,4-dioxo-1H-pyrimidin-5-yl)sulfonyl]-3,3-dimethylpiperazine-2,6-dione |
| SMILES | CC1(C)C(=O)NC(=O)CN1S(=O)(=O)c1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H12N4O6S/c1-10(2)8(17)12-6(15)4-14(10)21(19,20)5-3-11-9(18)13-7(5)16/h3H,4H2,1-2H3,(H,12,15,17)(H2,11,13,16,18) |
| InChIKey | OJIRPMYWMXJMCT-UHFFFAOYSA-N |
| XLogP | -2.51 |
| TPSA | 149.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.30 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|