C13H14FN3O2S — CID 66075019
2-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)-5-fluorobenzenecarbothioamide (PubChem CID 66075019) has the molecular formula C13H14FN3O2S and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)-5-fluorobenzenecarbothioamide.
| Compound Name | 2-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)-5-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 66075019 |
| Molecular Formula | C13H14FN3O2S |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 2-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)-5-fluorobenzenecarbothioamide |
| SMILES | CC1(C)C(=O)NC(=O)CN1c1ccc(F)cc1C(N)=S |
| InChI | InChI=1S/C13H14FN3O2S/c1-13(2)12(19)16-10(18)6-17(13)9-4-3-7(14)5-8(9)11(15)20/h3-5H,6H2,1-2H3,(H2,15,20)(H,16,18,19) |
| InChIKey | SSMUWJODSFNSSY-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|