About 2-(2-methyl-3,5-dioxopiperazin-1-yl)pyridine-4-carbonitrile
2-(2-methyl-3,5-dioxopiperazin-1-yl)pyridine-4-carbonitrile (PubChem CID 66075430) has the molecular formula C11H10N4O2
and a molecular weight of 230.23 g/mol. Its IUPAC name is 2-(2-methyl-3,5-dioxopiperazin-1-yl)pyridine-4-carbonitrile.
Molecular Properties
| Compound Name | 2-(2-methyl-3,5-dioxopiperazin-1-yl)pyridine-4-carbonitrile |
| PubChem CID | 66075430 |
| Molecular Formula | C11H10N4O2 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 2-(2-methyl-3,5-dioxopiperazin-1-yl)pyridine-4-carbonitrile |
| SMILES | CC1C(=O)NC(=O)CN1c1cc(C#N)ccn1 |
| InChI | InChI=1S/C11H10N4O2/c1-7-11(17)14-10(16)6-15(7)9-4-8(5-12)2-3-13-9/h2-4,7H,6H2,1H3,(H,14,16,17) |
| InChIKey | NDRPHOHTBVSKGB-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methyl-3,5-dioxopiperazin-1-yl)pyridine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methyl-3,5-dioxopiperazin-1-yl)pyridine-4-carbonitrile?
The IUPAC name of 2-(2-methyl-3,5-dioxopiperazin-1-yl)pyridine-4-carbonitrile (CID 66075430) is 2-(2-methyl-3,5-dioxopiperazin-1-yl)pyridine-4-carbonitrile.
What is the SMILES notation for 2-(2-methyl-3,5-dioxopiperazin-1-yl)pyridine-4-carbonitrile?
The canonical SMILES for 2-(2-methyl-3,5-dioxopiperazin-1-yl)pyridine-4-carbonitrile is CC1C(=O)NC(=O)CN1c1cc(C#N)ccn1.
What is the InChIKey of 2-(2-methyl-3,5-dioxopiperazin-1-yl)pyridine-4-carbonitrile?
The InChIKey is NDRPHOHTBVSKGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4O2/c1-7-11(17)14-10(16)6-15(7)9-4-8(5-12)2-3-13-9/h2-4,7H,6H2,1H3,(H,14,16,17).
What are the key properties of 2-(2-methyl-3,5-dioxopiperazin-1-yl)pyridine-4-carbonitrile?
2-(2-methyl-3,5-dioxopiperazin-1-yl)pyridine-4-carbonitrile has a molecular weight of 230.23 g/mol, XLogP of -0.20, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-3,5-dioxopiperazin-1-yl)pyridine-4-carbonitrile is sourced from PubChem (CID 66075430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).