C12H18N4O2S — CID 66075606
3,3-dimethyl-4-[4-[1-(methylamino)ethyl]-1,3-thiazol-2-yl]piperazine-2,6-dione (PubChem CID 66075606) has the molecular formula C12H18N4O2S and a molecular weight of 282.37 g/mol. Its IUPAC name is 3,3-dimethyl-4-[4-[1-(methylamino)ethyl]-1,3-thiazol-2-yl]piperazine-2,6-dione.
| Compound Name | 3,3-dimethyl-4-[4-[1-(methylamino)ethyl]-1,3-thiazol-2-yl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 66075606 |
| Molecular Formula | C12H18N4O2S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 3,3-dimethyl-4-[4-[1-(methylamino)ethyl]-1,3-thiazol-2-yl]piperazine-2,6-dione |
| SMILES | CNC(C)c1csc(N2CC(=O)NC(=O)C2(C)C)n1 |
| InChI | InChI=1S/C12H18N4O2S/c1-7(13-4)8-6-19-11(14-8)16-5-9(17)15-10(18)12(16,2)3/h6-7,13H,5H2,1-4H3,(H,15,17,18) |
| InChIKey | IUNJRZFGMKLFRT-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|