C13H15N3O4S — CID 66075640
4-(2,3-dihydro-1H-indol-5-ylsulfonyl)-3-methylpiperazine-2,6-dione (PubChem CID 66075640) has the molecular formula C13H15N3O4S and a molecular weight of 309.35 g/mol. Its IUPAC name is 4-(2,3-dihydro-1H-indol-5-ylsulfonyl)-3-methylpiperazine-2,6-dione.
| Compound Name | 4-(2,3-dihydro-1H-indol-5-ylsulfonyl)-3-methylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66075640 |
| Molecular Formula | C13H15N3O4S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 4-(2,3-dihydro-1H-indol-5-ylsulfonyl)-3-methylpiperazine-2,6-dione |
| SMILES | CC1C(=O)NC(=O)CN1S(=O)(=O)c1ccc2c(c1)CCN2 |
| InChI | InChI=1S/C13H15N3O4S/c1-8-13(18)15-12(17)7-16(8)21(19,20)10-2-3-11-9(6-10)4-5-14-11/h2-3,6,8,14H,4-5,7H2,1H3,(H,15,17,18) |
| InChIKey | CHASOJVHVSISAN-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|