C14H17FN2O3 — CID 66075751
4-[3-fluoro-2-[(1R)-1-hydroxyethyl]phenyl]-3,3-dimethylpiperazine-2,6-dione (PubChem CID 66075751) has the molecular formula C14H17FN2O3 and a molecular weight of 280.30 g/mol. Its IUPAC name is 4-[3-fluoro-2-[(1R)-1-hydroxyethyl]phenyl]-3,3-dimethylpiperazine-2,6-dione.
| Compound Name | 4-[3-fluoro-2-[(1R)-1-hydroxyethyl]phenyl]-3,3-dimethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66075751 |
| Molecular Formula | C14H17FN2O3 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 4-[3-fluoro-2-[(1R)-1-hydroxyethyl]phenyl]-3,3-dimethylpiperazine-2,6-dione |
| SMILES | C[C@@H](O)c1c(F)cccc1N1CC(=O)NC(=O)C1(C)C |
| InChI | InChI=1S/C14H17FN2O3/c1-8(18)12-9(15)5-4-6-10(12)17-7-11(19)16-13(20)14(17,2)3/h4-6,8,18H,7H2,1-3H3,(H,16,19,20)/t8-/m1/s1 |
| InChIKey | LORUHOAEDKYJIU-MRVPVSSYSA-N |
| XLogP | 1.12 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|