C10H14N4O4S — CID 66075775
3,3-dimethyl-4-[(5-methyl-1H-pyrazol-4-yl)sulfonyl]piperazine-2,6-dione (PubChem CID 66075775) has the molecular formula C10H14N4O4S and a molecular weight of 286.31 g/mol. Its IUPAC name is 3,3-dimethyl-4-[(5-methyl-1H-pyrazol-4-yl)sulfonyl]piperazine-2,6-dione.
| Compound Name | 3,3-dimethyl-4-[(5-methyl-1H-pyrazol-4-yl)sulfonyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 66075775 |
| Molecular Formula | C10H14N4O4S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | 3,3-dimethyl-4-[(5-methyl-1H-pyrazol-4-yl)sulfonyl]piperazine-2,6-dione |
| SMILES | Cc1[nH]ncc1S(=O)(=O)N1CC(=O)NC(=O)C1(C)C |
| InChI | InChI=1S/C10H14N4O4S/c1-6-7(4-11-13-6)19(17,18)14-5-8(15)12-9(16)10(14,2)3/h4H,5H2,1-3H3,(H,11,13)(H,12,15,16) |
| InChIKey | FVEJMHWPNQROEZ-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 112.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|