C9H12N6O3 — CID 66075779
4-(3-amino-1H-1,2,4-triazole-5-carbonyl)-3,3-dimethylpiperazine-2,6-dione (PubChem CID 66075779) has the molecular formula C9H12N6O3 and a molecular weight of 252.23 g/mol. Its IUPAC name is 4-(3-amino-1H-1,2,4-triazole-5-carbonyl)-3,3-dimethylpiperazine-2,6-dione.
| Compound Name | 4-(3-amino-1H-1,2,4-triazole-5-carbonyl)-3,3-dimethylpiperazine-2,6-dione |
|---|---|
| PubChem CID | 66075779 |
| Molecular Formula | C9H12N6O3 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 4-(3-amino-1H-1,2,4-triazole-5-carbonyl)-3,3-dimethylpiperazine-2,6-dione |
| SMILES | CC1(C)C(=O)NC(=O)CN1C(=O)c1nc(N)n[nH]1 |
| InChI | InChI=1S/C9H12N6O3/c1-9(2)7(18)11-4(16)3-15(9)6(17)5-12-8(10)14-13-5/h3H2,1-2H3,(H,11,16,18)(H3,10,12,13,14) |
| InChIKey | LBPJUDGJZSZKNI-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|