C16H25N3O2 — CID 66075911
2-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)-4-propylcyclohexane-1-carbonitrile (PubChem CID 66075911) has the molecular formula C16H25N3O2 and a molecular weight of 291.39 g/mol. Its IUPAC name is 2-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)-4-propylcyclohexane-1-carbonitrile.
| Compound Name | 2-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)-4-propylcyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 66075911 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 2-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)-4-propylcyclohexane-1-carbonitrile |
| SMILES | CCCC1CCC(C#N)C(N2CC(=O)NC(=O)C2(C)C)C1 |
| InChI | InChI=1S/C16H25N3O2/c1-4-5-11-6-7-12(9-17)13(8-11)19-10-14(20)18-15(21)16(19,2)3/h11-13H,4-8,10H2,1-3H3,(H,18,20,21) |
| InChIKey | XBNPLZHMJJUZBI-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|