C12H17N3O4S — CID 66075959
3,3-dimethyl-4-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoyl]piperazine-2,6-dione (PubChem CID 66075959) has the molecular formula C12H17N3O4S and a molecular weight of 299.35 g/mol. Its IUPAC name is 3,3-dimethyl-4-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoyl]piperazine-2,6-dione.
| Compound Name | 3,3-dimethyl-4-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 66075959 |
| Molecular Formula | C12H17N3O4S |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | 3,3-dimethyl-4-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoyl]piperazine-2,6-dione |
| SMILES | CC1(C)C(=O)NC(=O)CN1C(=O)CCN1CCSC1=O |
| InChI | InChI=1S/C12H17N3O4S/c1-12(2)10(18)13-8(16)7-15(12)9(17)3-4-14-5-6-20-11(14)19/h3-7H2,1-2H3,(H,13,16,18) |
| InChIKey | IBANNRCROPZFLE-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|