C13H21N3O2 — CID 66076098
5-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)-2,2-dimethylpentanenitrile (PubChem CID 66076098) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 5-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)-2,2-dimethylpentanenitrile.
| Compound Name | 5-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 66076098 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 5-(2,2-dimethyl-3,5-dioxopiperazin-1-yl)-2,2-dimethylpentanenitrile |
| SMILES | CC(C)(C#N)CCCN1CC(=O)NC(=O)C1(C)C |
| InChI | InChI=1S/C13H21N3O2/c1-12(2,9-14)6-5-7-16-8-10(17)15-11(18)13(16,3)4/h5-8H2,1-4H3,(H,15,17,18) |
| InChIKey | LXGJJTPDWWZBJA-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|