C11H15N3O5S — CID 66076382
(4R)-3-(2,2-dimethyl-3,5-dioxopiperazine-1-carbonyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 66076382) has the molecular formula C11H15N3O5S and a molecular weight of 301.32 g/mol. Its IUPAC name is (4R)-3-(2,2-dimethyl-3,5-dioxopiperazine-1-carbonyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4R)-3-(2,2-dimethyl-3,5-dioxopiperazine-1-carbonyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 66076382 |
| Molecular Formula | C11H15N3O5S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | (4R)-3-(2,2-dimethyl-3,5-dioxopiperazine-1-carbonyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CC1(C)C(=O)NC(=O)CN1C(=O)N1CSC[C@H]1C(=O)O |
| InChI | InChI=1S/C11H15N3O5S/c1-11(2)9(18)12-7(15)3-14(11)10(19)13-5-20-4-6(13)8(16)17/h6H,3-5H2,1-2H3,(H,16,17)(H,12,15,18)/t6-/m0/s1 |
| InChIKey | RXKOGRJFLGIJTO-LURJTMIESA-N |
| XLogP | -0.70 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|