About 2-[2-(2,3-dihydroindol-1-yl)ethyl]isoindole-1,3-dione
2-[2-(2,3-dihydroindol-1-yl)ethyl]isoindole-1,3-dione (PubChem CID 660765) has the molecular formula C18H16N2O2
and a molecular weight of 292.34 g/mol. Its IUPAC name is 2-[2-(2,3-dihydroindol-1-yl)ethyl]isoindole-1,3-dione.
Molecular Properties
| Compound Name | 2-[2-(2,3-dihydroindol-1-yl)ethyl]isoindole-1,3-dione |
| PubChem CID | 660765 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2-[2-(2,3-dihydroindol-1-yl)ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCN1CCc2ccccc21 |
| InChI | InChI=1S/C18H16N2O2/c21-17-14-6-2-3-7-15(14)18(22)20(17)12-11-19-10-9-13-5-1-4-8-16(13)19/h1-8H,9-12H2 |
| InChIKey | YIIIUEPNRRQDPZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_L(1)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2,3-dihydroindol-1-yl)ethyl]isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2,3-dihydroindol-1-yl)ethyl]isoindole-1,3-dione?
The IUPAC name of 2-[2-(2,3-dihydroindol-1-yl)ethyl]isoindole-1,3-dione (CID 660765) is 2-[2-(2,3-dihydroindol-1-yl)ethyl]isoindole-1,3-dione.
What is the SMILES notation for 2-[2-(2,3-dihydroindol-1-yl)ethyl]isoindole-1,3-dione?
The canonical SMILES for 2-[2-(2,3-dihydroindol-1-yl)ethyl]isoindole-1,3-dione is O=C1c2ccccc2C(=O)N1CCN1CCc2ccccc21.
What is the InChIKey of 2-[2-(2,3-dihydroindol-1-yl)ethyl]isoindole-1,3-dione?
The InChIKey is YIIIUEPNRRQDPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O2/c21-17-14-6-2-3-7-15(14)18(22)20(17)12-11-19-10-9-13-5-1-4-8-16(13)19/h1-8H,9-12H2.
What are the key properties of 2-[2-(2,3-dihydroindol-1-yl)ethyl]isoindole-1,3-dione?
2-[2-(2,3-dihydroindol-1-yl)ethyl]isoindole-1,3-dione has a molecular weight of 292.34 g/mol, XLogP of 2.35, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2,3-dihydroindol-1-yl)ethyl]isoindole-1,3-dione is sourced from PubChem (CID 660765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).