About 5-chloro-2-(2,5-dimethylmorpholin-4-yl)-4-fluoroaniline
5-chloro-2-(2,5-dimethylmorpholin-4-yl)-4-fluoroaniline (PubChem CID 66076821) has the molecular formula C12H16ClFN2O
and a molecular weight of 258.72 g/mol. Its IUPAC name is 5-chloro-2-(2,5-dimethylmorpholin-4-yl)-4-fluoroaniline.
Molecular Properties
| Compound Name | 5-chloro-2-(2,5-dimethylmorpholin-4-yl)-4-fluoroaniline |
| PubChem CID | 66076821 |
| Molecular Formula | C12H16ClFN2O |
| Molecular Weight | 258.72 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 5-chloro-2-(2,5-dimethylmorpholin-4-yl)-4-fluoroaniline |
| SMILES | CC1CN(c2cc(F)c(Cl)cc2N)C(C)CO1 |
| InChI | InChI=1S/C12H16ClFN2O/c1-7-6-17-8(2)5-16(7)12-4-10(14)9(13)3-11(12)15/h3-4,7-8H,5-6,15H2,1-2H3 |
| InChIKey | ZKNLQHGHRRIKGL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.72 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-(2,5-dimethylmorpholin-4-yl)-4-fluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-(2,5-dimethylmorpholin-4-yl)-4-fluoroaniline?
The IUPAC name of 5-chloro-2-(2,5-dimethylmorpholin-4-yl)-4-fluoroaniline (CID 66076821) is 5-chloro-2-(2,5-dimethylmorpholin-4-yl)-4-fluoroaniline.
What is the SMILES notation for 5-chloro-2-(2,5-dimethylmorpholin-4-yl)-4-fluoroaniline?
The canonical SMILES for 5-chloro-2-(2,5-dimethylmorpholin-4-yl)-4-fluoroaniline is CC1CN(c2cc(F)c(Cl)cc2N)C(C)CO1.
What is the InChIKey of 5-chloro-2-(2,5-dimethylmorpholin-4-yl)-4-fluoroaniline?
The InChIKey is ZKNLQHGHRRIKGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16ClFN2O/c1-7-6-17-8(2)5-16(7)12-4-10(14)9(13)3-11(12)15/h3-4,7-8H,5-6,15H2,1-2H3.
What are the key properties of 5-chloro-2-(2,5-dimethylmorpholin-4-yl)-4-fluoroaniline?
5-chloro-2-(2,5-dimethylmorpholin-4-yl)-4-fluoroaniline has a molecular weight of 258.72 g/mol, XLogP of 2.67, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-(2,5-dimethylmorpholin-4-yl)-4-fluoroaniline is sourced from PubChem (CID 66076821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).