About 4-chloro-1-N,1-N-bis(cyclopropylmethyl)-5-fluorobenzene-1,2-diamine
4-chloro-1-N,1-N-bis(cyclopropylmethyl)-5-fluorobenzene-1,2-diamine (PubChem CID 66077466) has the molecular formula C14H18ClFN2
and a molecular weight of 268.76 g/mol. Its IUPAC name is 4-chloro-1-N,1-N-bis(cyclopropylmethyl)-5-fluorobenzene-1,2-diamine.
Molecular Properties
| Compound Name | 4-chloro-1-N,1-N-bis(cyclopropylmethyl)-5-fluorobenzene-1,2-diamine |
| PubChem CID | 66077466 |
| Molecular Formula | C14H18ClFN2 |
| Molecular Weight | 268.76 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 4-chloro-1-N,1-N-bis(cyclopropylmethyl)-5-fluorobenzene-1,2-diamine |
| SMILES | Nc1cc(Cl)c(F)cc1N(CC1CC1)CC1CC1 |
| InChI | InChI=1S/C14H18ClFN2/c15-11-5-13(17)14(6-12(11)16)18(7-9-1-2-9)8-10-3-4-10/h5-6,9-10H,1-4,7-8,17H2 |
| InChIKey | CCYWHDYRNRBMEG-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.76 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-1-N,1-N-bis(cyclopropylmethyl)-5-fluorobenzene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1-N,1-N-bis(cyclopropylmethyl)-5-fluorobenzene-1,2-diamine?
The IUPAC name of 4-chloro-1-N,1-N-bis(cyclopropylmethyl)-5-fluorobenzene-1,2-diamine (CID 66077466) is 4-chloro-1-N,1-N-bis(cyclopropylmethyl)-5-fluorobenzene-1,2-diamine.
What is the SMILES notation for 4-chloro-1-N,1-N-bis(cyclopropylmethyl)-5-fluorobenzene-1,2-diamine?
The canonical SMILES for 4-chloro-1-N,1-N-bis(cyclopropylmethyl)-5-fluorobenzene-1,2-diamine is Nc1cc(Cl)c(F)cc1N(CC1CC1)CC1CC1.
What is the InChIKey of 4-chloro-1-N,1-N-bis(cyclopropylmethyl)-5-fluorobenzene-1,2-diamine?
The InChIKey is CCYWHDYRNRBMEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18ClFN2/c15-11-5-13(17)14(6-12(11)16)18(7-9-1-2-9)8-10-3-4-10/h5-6,9-10H,1-4,7-8,17H2.
What are the key properties of 4-chloro-1-N,1-N-bis(cyclopropylmethyl)-5-fluorobenzene-1,2-diamine?
4-chloro-1-N,1-N-bis(cyclopropylmethyl)-5-fluorobenzene-1,2-diamine has a molecular weight of 268.76 g/mol, XLogP of 3.69, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1-N,1-N-bis(cyclopropylmethyl)-5-fluorobenzene-1,2-diamine is sourced from PubChem (CID 66077466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).