C14H18ClFN2O3 — CID 66077597
[1-(4-chloro-5-fluoro-2-nitroanilino)-4-methylcyclohexyl]methanol (PubChem CID 66077597) has the molecular formula C14H18ClFN2O3 and a molecular weight of 316.76 g/mol. Its IUPAC name is [1-(4-chloro-5-fluoro-2-nitroanilino)-4-methylcyclohexyl]methanol.
| Compound Name | [1-(4-chloro-5-fluoro-2-nitroanilino)-4-methylcyclohexyl]methanol |
|---|---|
| PubChem CID | 66077597 |
| Molecular Formula | C14H18ClFN2O3 |
| Molecular Weight | 316.76 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | [1-(4-chloro-5-fluoro-2-nitroanilino)-4-methylcyclohexyl]methanol |
| SMILES | CC1CCC(CO)(Nc2cc(F)c(Cl)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C14H18ClFN2O3/c1-9-2-4-14(8-19,5-3-9)17-12-7-11(16)10(15)6-13(12)18(20)21/h6-7,9,17,19H,2-5,8H2,1H3 |
| InChIKey | PNOWCEMOVLQIDC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.76 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|