C23H38N2O6 — CID 6607842
2-[(3S,6R)-3-(cyclohexylmethyl)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]-N-[2-(2-hydroxyethoxy)ethyl]acetamide (PubChem CID 6607842) has the molecular formula C23H38N2O6 and a molecular weight of 438.57 g/mol. Its IUPAC name is 2-[(3S,6R)-3-(cyclohexylmethyl)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]-N-[2-(2-hydroxyethoxy)ethyl]acetamide.
| Compound Name | 2-[(3S,6R)-3-(cyclohexylmethyl)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]-N-[2-(2-hydroxyethoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 6607842 |
| Molecular Formula | C23H38N2O6 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | 2-[(3S,6R)-3-(cyclohexylmethyl)-5,12-dioxo-1-oxa-4-azacyclododec-8-en-6-yl]-N-[2-(2-hydroxyethoxy)ethyl]acetamide |
| SMILES | O=C(C[C@H]1CC=CCCC(=O)OC[C@H](CC2CCCCC2)NC1=O)NCCOCCO |
| InChI | InChI=1S/C23H38N2O6/c26-12-14-30-13-11-24-21(27)16-19-9-5-2-6-10-22(28)31-17-20(25-23(19)29)15-18-7-3-1-4-8-18/h2,5,18-20,26H,1,3-4,6-17H2,(H,24,27)(H,25,29)/t19-,20+/m1/s1 |
| InChIKey | FZYKAVAXOVGZOQ-UXHICEINSA-N |
| XLogP | 1.86 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|